
CAS 1330750-42-9
:3-Pyrrolidinecarboxylic acid, 4-(1-naphthalenyl)-, hydrochloride (1:1), (3R,4S)-rel-
Description:
3-Pyrrolidinecarboxylic acid, 4-(1-naphthalenyl)-, hydrochloride (1:1), (3R,4S)-rel- is a chemical compound characterized by its specific stereochemistry and functional groups. It features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and a carboxylic acid functional group that contributes to its acidity and potential reactivity. The presence of a naphthalenyl group indicates that it has a polycyclic aromatic structure, which can influence its hydrophobicity and interactions with biological systems. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The (3R,4S)-rel- designation indicates the specific stereochemical configuration at the chiral centers, which is crucial for its biological activity and interaction with receptors or enzymes. Overall, this compound may have implications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways.
Formula:C15H15NO2·ClH
InChI:InChI=1/C15H15NO2.ClH/c17-15(18)14-9-16-8-13(14)12-7-3-5-10-4-1-2-6-11(10)12;/h1-7,13-14,16H,8-9H2,(H,17,18);1H/t13-,14+;/s2
InChI key:InChIKey=PHHZADOJTQLSMJ-YHVXOJTMNA-N
SMILES:C(O)(=O)[C@@H]1[C@@H](C=2C3=C(C=CC2)C=CC=C3)CNC1.Cl
Synonyms:- 3-Pyrrolidinecarboxylic acid, 4-(1-naphthalenyl)-, hydrochloride (1:1), (3R,4S)-rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.