CymitQuimica logo

CAS 1330750-45-2

:

3-Chloro-4-methyl-2,6-dinitrophenol

Description:
3-Chloro-4-methyl-2,6-dinitrophenol, with the CAS number 1330750-45-2, is a chemical compound that belongs to the class of dinitrophenols. It is characterized by the presence of two nitro groups (-NO2) and a chlorine atom (-Cl) on a phenolic ring, along with a methyl group (-CH3). This compound typically exhibits a yellow to orange color and is known for its potential use in various applications, including as a herbicide and in chemical synthesis. Its structure contributes to its reactivity, particularly in electrophilic substitution reactions. The presence of the nitro groups enhances its acidity compared to phenol, making it a stronger acid. Additionally, 3-Chloro-4-methyl-2,6-dinitrophenol is considered hazardous, with potential toxic effects, necessitating careful handling and appropriate safety measures in laboratory and industrial settings. Its environmental impact and regulatory status should also be considered when evaluating its use.
Formula:C7H5ClN2O5
InChI:InChI=1S/C7H5ClN2O5/c1-3-2-4(9(12)13)7(11)6(5(3)8)10(14)15/h2,11H,1H3
InChI key:InChIKey=SSFPPEHPQLGLCK-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(O)C(N(=O)=O)=CC(C)=C1Cl
Synonyms:
  • 3-Chloro-4-methyl-2,6-dinitrophenol
  • Phenol, 3-chloro-4-methyl-2,6-dinitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.