CAS 1330750-47-4

3-Pyrrolidinecarboxylic acid, 4-(4-pyridinyl)-, hydrochloride (1:2), (3R,4S)-rel-

Description:

3-Pyrrolidinecarboxylic acid, 4-(4-pyridinyl)-, hydrochloride (1:2), (3R,4S)-rel- is a chemical compound characterized by its specific stereochemistry and functional groups. It features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and a carboxylic acid functional group, indicating its acidic nature. The presence of a pyridine moiety suggests potential interactions with biological systems, as pyridine derivatives are often involved in various pharmacological activities. The hydrochloride form indicates that the compound is a salt, which can enhance its solubility in water and stability. The (3R,4S)-rel- designation specifies the stereochemistry of the compound, which is crucial for its biological activity and interaction with receptors. This compound may be of interest in medicinal chemistry and drug development, particularly in the context of neuropharmacology or as a potential therapeutic agent. Its specific properties, such as solubility, melting point, and reactivity, would depend on the molecular structure and the presence of functional groups.

Formula: C₁₀H₁₄Cl₂N₂O₂

InChI: InChI=1/C10H12N2O2.2ClH/c13-10(14)9-6-12-5-8(9)7-1-3-11-4-2-7;;/h1-4,8-9,12H,5-6H2,(H,13,14);2*1H/t8-,9+;;/s2

InChI key: InChIKey=GUMWLQDUMJSNQW-WOTYSXQCNA-N

SMILES: C(O)(=O)[C@@H]1[C@H](CNC1)C=2C=CN=CC2.Cl

Synonyms:

• 3-Pyrrolidinecarboxylic acid, 4-(4-pyridinyl)-, hydrochloride (1:2), (3R,4S)-rel-
• Rac-(3r,4s)-4-(pyridin-4-yl)pyrrolidine-3-carboxylic acid dihydrochloride, trans
• (3R,4S)-4-(pyridin-4-yl)pyrrolidine-3-carboxylic acid dihydrochloride