CAS 1330750-48-5
:5-Bromo-6-fluoro-1-methyl-1H-benzotriazole
Description:
5-Bromo-6-fluoro-1-methyl-1H-benzotriazole is a heterocyclic organic compound characterized by the presence of a benzotriazole ring, which consists of two nitrogen atoms in a five-membered ring fused to a benzene ring. The compound features a bromine atom at the 5-position and a fluorine atom at the 6-position, contributing to its unique reactivity and potential applications in various chemical processes. The methyl group at the 1-position enhances its solubility and stability. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as a building block or intermediate. Its halogen substituents can influence its electronic properties, making it useful in applications such as dye synthesis and as a reagent in chemical reactions. Additionally, the presence of both bromine and fluorine can impart specific characteristics such as increased lipophilicity and altered biological activity, which are valuable in medicinal chemistry.
Formula:C7H5BrFN3
InChI:InChI=1S/C7H5BrFN3/c1-12-7-3-5(9)4(8)2-6(7)10-11-12/h2-3H,1H3
InChI key:InChIKey=KCXBGSDYACQLLB-UHFFFAOYSA-N
SMILES:CN1C=2C(=CC(Br)=C(F)C2)N=N1
Synonyms:- 5-Bromo-6-fluoro-1-methyl-1,2,3-benzotriazole
- 5-Bromo-6-fluoro-1-methylbenzotriazole
- 5-Bromo-6-fluoro-1-methyl-1H-benzotriazole
- 1H-Benzotriazole, 5-bromo-6-fluoro-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Benzotriazole, 5-bromo-6-fluoro-1-methyl-
CAS:Formula:C7H5BrFN3Color and Shape:SolidMolecular weight:230.0371
