CAS 1330750-62-3: 5-Bromo-3-methoxyisoquinoline

Description:5-Bromo-3-methoxyisoquinoline is an organic compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 5-position and a methoxy group at the 3-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its aromatic nature. The bromine substituent can enhance the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The methoxy group can influence the electronic properties of the molecule, potentially affecting its reactivity and interaction with biological targets. 5-Bromo-3-methoxyisoquinoline may also exhibit interesting pharmacological activities, making it of interest in medicinal chemistry. Its structural features suggest potential applications in the development of pharmaceuticals or agrochemicals, although specific biological activities would require further investigation. Overall, this compound represents a valuable scaffold for synthetic and medicinal chemistry research.

Formula:C₁₀H₈BrNO

InChI:InChI=1S/C10H8BrNO/c1-13-10-5-8-7(6-12-10)3-2-4-9(8)11/h2-6H,1H3

InChI key:InChIKey=AQOJBAYGTPZJAY-UHFFFAOYSA-N

SMILES:BrC=1C=CC=C2C=NC(OC)=CC12

Synonyms:
5-Bromo-3-methoxyisoquinoline
Isoquinoline, 5-bromo-3-methoxy-

Found 5 products.

Product data	Purity	Price range	Estimated delivery
5-Bromo-3-methoxyisoquinoline REF: IN-DA009DEGCAS: 1330750-62-3	97%	To inquire	Tue 15 Apr 25
5-Bromo-3-methoxyisoquinoline REF: 54-OR300102CAS: 1330750-62-3	97%	140.00 €~1,606.00 €	Wed 16 Apr 25
5-Bromo-3-methoxyisoquinoline REF: FT-B13496CAS: 1330750-62-3	>95%	To inquire	Mon 21 Apr 25
5-Bromo-3-methoxyisoquinoline REF: 10-F633585CAS: 1330750-62-3	97%	To inquire	Fri 25 Apr 25
5-Bromo-3-methoxyisoquinoline REF: 3D-FDC75062CAS: 1330750-62-3	Min. 95%	- - -	Discontinued product