CAS 1330750-76-9

6,8-Difluoro-3-iodo-4(1H)-quinolinone

Description:

6,8-Difluoro-3-iodo-4(1H)-quinolinone is a synthetic organic compound characterized by its quinolinone structure, which features a fused bicyclic system containing both a benzene and a pyridine ring. The presence of two fluorine atoms at the 6 and 8 positions and an iodine atom at the 3 position contributes to its unique chemical properties, including increased lipophilicity and potential for biological activity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure allows for various interactions with biological targets, potentially influencing its reactivity and stability. Additionally, the halogen substituents can enhance its ability to participate in further chemical reactions, such as nucleophilic substitutions or coupling reactions. As with many halogenated compounds, considerations regarding its environmental impact and toxicity are essential in its application and handling. Overall, 6,8-Difluoro-3-iodo-4(1H)-quinolinone represents a versatile scaffold for further chemical exploration and development in various fields, including pharmaceuticals and agrochemicals.

Formula: C₉H₄F₂INO

InChI: InChI=1S/C9H4F2INO/c10-4-1-5-8(6(11)2-4)13-3-7(12)9(5)14/h1-3H,(H,13,14)

InChI key: InChIKey=BJXQNGBWBPOPNS-UHFFFAOYSA-N

SMILES: FC1=C2C(C(=O)C(I)=CN2)=CC(F)=C1

Synonyms:

• 4(1H)-Quinolinone, 6,8-difluoro-3-iodo-
• 6,8-Difluoro-3-iodo-4(1H)-quinolinone