
CAS 1330750-99-6
:2-Methyl-5-(4-morpholinyl)-8-nitroquinoline
Description:
2-Methyl-5-(4-morpholinyl)-8-nitroquinoline is a chemical compound characterized by its complex structure, which includes a quinoline core substituted with a methyl group, a nitro group, and a morpholine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the morpholine moiety, which is known for its role in medicinal chemistry. The nitro group can influence the compound's reactivity and polarity, potentially affecting its solubility in various solvents. Additionally, the presence of the methyl group can impact the compound's steric and electronic properties. As a member of the quinoline family, it may exhibit fluorescence and has potential applications in pharmaceuticals, particularly in the development of antimicrobial or anticancer agents. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for precise applications and handling guidelines.
Formula:C14H15N3O3
InChI:InChI=1S/C14H15N3O3/c1-10-2-3-11-12(16-6-8-20-9-7-16)4-5-13(17(18)19)14(11)15-10/h2-5H,6-9H2,1H3
InChI key:InChIKey=WIESUWXKMGHWLW-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C2=C(C(=CC1)N3CCOCC3)C=CC(C)=N2
Synonyms:- 2-Methyl-5-(4-morpholinyl)-8-nitroquinoline
- Quinoline, 2-methyl-5-(4-morpholinyl)-8-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.