CAS 1330751-10-4

N,N,8-Trimethylpyrido[2,3-d]pyridazin-5-amine

Description:

N,N,8-Trimethylpyrido[2,3-d]pyridazin-5-amine is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyridazine rings. This compound features three methyl groups attached to the nitrogen atoms, contributing to its unique chemical properties and potential biological activity. The presence of multiple nitrogen atoms in the ring system can influence its reactivity and solubility, making it of interest in medicinal chemistry and drug design. The compound may exhibit various pharmacological activities, potentially acting as a ligand or inhibitor in biological systems. Its molecular structure suggests that it could participate in hydrogen bonding and other interactions, which are critical for its function in biological contexts. Additionally, the compound's stability, melting point, and solubility characteristics would be essential for its application in research and development. Overall, N,N,8-Trimethylpyrido[2,3-d]pyridazin-5-amine represents a class of compounds that may hold promise for further exploration in chemical and pharmaceutical sciences.

Formula: C₁₀H₁₂N₄

InChI: InChI=1S/C10H12N4/c1-7-9-8(5-4-6-11-9)10(13-12-7)14(2)3/h4-6H,1-3H3

InChI key: InChIKey=OMGSNUBNPDOBMQ-UHFFFAOYSA-N

SMILES: N(C)(C)C=1C2=C(C(C)=NN1)N=CC=C2

Synonyms:

• N,N,8-Trimethylpyrido[2,3-d]pyridazin-5-amine
• Pyrido[2,3-d]pyridazin-5-amine, N,N,8-trimethyl-