CAS 1330752-22-1

2,6-Dimethyl-4-piperidinecarboxylic acid

Description:

2,6-Dimethyl-4-piperidinecarboxylic acid is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features two methyl groups at the 2 and 6 positions of the piperidine ring and a carboxylic acid functional group at the 4 position. The presence of the carboxylic acid group imparts acidic properties to the molecule, allowing it to participate in various chemical reactions, such as esterification and amidation. The methyl substituents contribute to the compound's steric and electronic properties, potentially influencing its reactivity and interactions with biological systems. This compound may be of interest in medicinal chemistry and organic synthesis due to its structural features, which can be modified for the development of pharmaceuticals or agrochemicals. Additionally, its solubility and stability in different solvents can vary, making it important to consider these factors in practical applications. Overall, 2,6-Dimethyl-4-piperidinecarboxylic acid is a versatile compound with potential utility in various chemical and biological contexts.

Formula: C₈H₁₅NO₂

InChI: InChI=1S/C8H15NO2/c1-5-3-7(8(10)11)4-6(2)9-5/h5-7,9H,3-4H2,1-2H3,(H,10,11)

InChI key: InChIKey=ZFUAHVNAKAJLAL-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CC(C)NC(C)C1

Synonyms:

• 4-Piperidinecarboxylic acid, 2,6-dimethyl-
• 2,6-Dimethyl-4-piperidinecarboxylic acid