
CAS 1330752-83-4
:5-Bromo-1-(1-pyrrolidinyl)isoquinoline
Description:
5-Bromo-1-(1-pyrrolidinyl)isoquinoline is a chemical compound characterized by its isoquinoline core structure, which is a bicyclic aromatic compound. The presence of a bromine atom at the 5-position of the isoquinoline ring introduces halogenation, which can influence the compound's reactivity and biological activity. The pyrrolidinyl group, attached at the 1-position, contributes to the compound's potential as a pharmacophore, possibly enhancing its interaction with biological targets. This compound may exhibit properties such as lipophilicity due to its aromatic nature, which can affect its solubility and permeability in biological systems. Additionally, the presence of both the bromine and the pyrrolidinyl moiety suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. The compound's specific reactivity, stability, and biological effects would depend on its molecular interactions and the context of its use in research or pharmaceutical applications. As with many organic compounds, safety and handling precautions should be observed due to the presence of halogens and potential biological activity.
Formula:C13H13BrN2
InChI:InChI=1S/C13H13BrN2/c14-12-5-3-4-11-10(12)6-7-15-13(11)16-8-1-2-9-16/h3-7H,1-2,8-9H2
InChI key:InChIKey=PLDBQPAZOXCPEY-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C(=NC=C2)N3CCCC3)C=CC1
Synonyms:- 5-Bromo-1-(1-pyrrolidinyl)isoquinoline
- Isoquinoline, 5-bromo-1-(1-pyrrolidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.