
CAS 1330752-84-5
:4-(2-Benzothiazolyl)-1H-pyrrole-3-carboxylic acid
Description:
4-(2-Benzothiazolyl)-1H-pyrrole-3-carboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrrole ring fused with a benzothiazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of both carboxylic acid and heterocyclic functional groups. The benzothiazole component often contributes to its biological activity, making it of interest in medicinal chemistry and material science. The compound may display fluorescence properties, which can be advantageous in various applications, including sensors and dyes. Additionally, its acidic nature allows for potential interactions in biological systems, influencing its pharmacological profile. Overall, the combination of its structural features and functional groups suggests that 4-(2-Benzothiazolyl)-1H-pyrrole-3-carboxylic acid could be a versatile compound with applications in research and industry, particularly in the development of novel therapeutic agents or materials.
Formula:C12H8N2O2S
InChI:InChI=1S/C12H8N2O2S/c15-12(16)8-6-13-5-7(8)11-14-9-3-1-2-4-10(9)17-11/h1-6,13H,(H,15,16)
InChI key:InChIKey=GPZSAZVMKJPKJC-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(C2=NC=3C(S2)=CC=CC3)=CNC1
Synonyms:- 1H-Pyrrole-3-carboxylic acid, 4-(2-benzothiazolyl)-
- 4-(2-Benzothiazolyl)-1H-pyrrole-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.