
CAS 1330752-97-0
:4-Propoxy-6-benzofuranamine
Description:
4-Propoxy-6-benzofuranamine is an organic compound characterized by its unique structural features, which include a benzofuran moiety and a propoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the benzofuran ring suggests that it may engage in π-π stacking interactions, which can influence its solubility and reactivity. The propoxy group enhances its lipophilicity, potentially affecting its pharmacokinetic properties. As an amine, it may participate in hydrogen bonding, which can be crucial for its interaction with biological targets. The compound's specific characteristics, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the environment in which it is studied. Additionally, its potential applications could span various fields, including medicinal chemistry and materials science, depending on its biological activity and stability. Further research would be necessary to fully elucidate its properties and potential uses.
Formula:C11H13NO2
InChI:InChI=1S/C11H13NO2/c1-2-4-13-10-6-8(12)7-11-9(10)3-5-14-11/h3,5-7H,2,4,12H2,1H3
InChI key:InChIKey=ZBKVBNYLZGRIPC-UHFFFAOYSA-N
SMILES:O(CCC)C1=C2C(=CC(N)=C1)OC=C2
Synonyms:- 6-Benzofuranamine, 4-propoxy-
- 4-Propoxy-6-benzofuranamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.