CAS 1330754-09-0

5-Bromo-1-isoquinolinemethanol

Description:

5-Bromo-1-isoquinolinemethanol is a chemical compound characterized by its isoquinoline structure, which features a bromine atom at the 5-position and a hydroxymethyl group attached to the nitrogen-containing aromatic ring. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydroxymethyl group. The bromine substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of the isoquinoline moiety may impart biological activity, making it of interest in medicinal chemistry for potential pharmacological applications. Its molecular structure suggests that it could participate in hydrogen bonding, affecting its physical properties such as melting point and boiling point. As with many brominated compounds, it may also exhibit unique electronic properties due to the halogen's influence on the electron distribution within the molecule. Safety and handling precautions should be observed, as with any chemical substance, particularly those that may have toxicological implications.

Formula: C₁₀H₈BrNO

InChI: InChI=1S/C10H8BrNO/c11-9-3-1-2-8-7(9)4-5-12-10(8)6-13/h1-5,13H,6H2

InChI key: InChIKey=ONSCHMLRHHLALM-UHFFFAOYSA-N

SMILES: C(O)C=1C2=C(C(Br)=CC=C2)C=CN1

Synonyms:

• 1-Isoquinolinemethanol, 5-bromo-
• 5-Bromo-1-isoquinolinemethanol