
CAS 1330755-16-2
:5-Bromo-N,N-dimethyl-1-isoquinolinamine
Description:
5-Bromo-N,N-dimethyl-1-isoquinolinamine is a chemical compound characterized by its isoquinoline structure, which features a bromine atom at the 5-position and two methyl groups attached to the nitrogen atom in the amine functional group. This compound is typically classified as a heterocyclic aromatic amine, which may exhibit various biological activities due to its structural properties. The presence of the bromine substituent can influence its reactivity and solubility, potentially enhancing its pharmacological profile. It may be utilized in medicinal chemistry for the development of therapeutic agents, particularly in the context of targeting specific biological pathways. The compound's molecular interactions, stability, and potential applications in drug discovery are subjects of interest in research. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, 5-Bromo-N,N-dimethyl-1-isoquinolinamine represents a significant entity in the realm of organic synthesis and medicinal chemistry.
Formula:C11H11BrN2
InChI:InChI=1S/C11H11BrN2/c1-14(2)11-9-4-3-5-10(12)8(9)6-7-13-11/h3-7H,1-2H3
InChI key:InChIKey=LHNAJJIILVZUEE-UHFFFAOYSA-N
SMILES:N(C)(C)C=1C2=C(C(Br)=CC=C2)C=CN1
Synonyms:- 5-Bromo-N,N-dimethyl-1-isoquinolinamine
- 1-Isoquinolinamine, 5-bromo-N,N-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.