CAS 1330756-30-3
:3-Chloro-1-ethyl-5-methoxy-1H-1,2,4-triazole
Description:
3-Chloro-1-ethyl-5-methoxy-1H-1,2,4-triazole is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a chloro substituent at the 3-position, an ethyl group at the 1-position, and a methoxy group at the 5-position of the triazole ring. The presence of these functional groups contributes to its unique chemical properties, including potential reactivity and solubility characteristics. Triazoles are known for their applications in agriculture, particularly as fungicides, and in pharmaceuticals due to their biological activity. The chlorine atom can enhance the compound's lipophilicity, potentially affecting its bioavailability and interaction with biological systems. Additionally, the methoxy group may influence the compound's electronic properties and steric hindrance. Overall, 3-Chloro-1-ethyl-5-methoxy-1H-1,2,4-triazole represents a class of compounds that may exhibit significant pharmacological and agricultural relevance, warranting further investigation into its applications and mechanisms of action.
Formula:C5H8ClN3O
InChI:InChI=1S/C5H8ClN3O/c1-3-9-5(10-2)7-4(6)8-9/h3H2,1-2H3
InChI key:InChIKey=VELPBSAKABINMO-UHFFFAOYSA-N
SMILES:O(C)C=1N(CC)N=C(Cl)N1
Synonyms:- 1H-1,2,4-Triazole, 3-chloro-1-ethyl-5-methoxy-
- 3-Chloro-1-ethyl-5-methoxy-1H-1,2,4-triazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.