CymitQuimica logo

CAS 1330756-31-4

:

Piperidine, 2-(1-methyl-1H-pyrazol-5-yl)-

Description:
Piperidine, 2-(1-methyl-1H-pyrazol-5-yl)- is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 1-methyl-1H-pyrazol-5-yl substituent introduces additional functional properties, as pyrazoles are known for their diverse biological activities. This compound typically exhibits a moderate polarity due to the presence of nitrogen atoms, which can participate in hydrogen bonding. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperidine derivatives are often associated with various therapeutic effects. The compound's molecular interactions may also be influenced by the electronic properties of the pyrazole moiety, which can affect its reactivity and binding affinity in biological systems. Overall, Piperidine, 2-(1-methyl-1H-pyrazol-5-yl)- is of interest for its potential utility in drug design and synthesis, although specific biological activities and properties would require further investigation through experimental studies.
Formula:C9H15N3
InChI:InChI=1S/C9H15N3/c1-12-9(5-7-11-12)8-4-2-3-6-10-8/h5,7-8,10H,2-4,6H2,1H3
InChI key:InChIKey=PDHQNRUUIJHWGJ-UHFFFAOYSA-N
SMILES:CN1C(=CC=N1)C2CCCCN2
Synonyms:
  • Piperidine, 2-(1-methyl-1H-pyrazol-5-yl)-
  • 2-(1-Methyl-1H-pyrazol-5-yl)piperidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.