CAS 1330763-24-0

1,1-Dimethylethyl 3-(aminomethyl)-2,6-dioxa-9-azaspiro[4.5]decane-9-carboxylate

Description:

1,1-Dimethylethyl 3-(aminomethyl)-2,6-dioxa-9-azaspiro[4.5]decane-9-carboxylate, identified by its CAS number 1330763-24-0, is a chemical compound characterized by its complex spirocyclic structure, which includes both nitrogen and oxygen functionalities. This compound features a spiro[4.5]decane framework, indicating a unique arrangement of carbon atoms that contributes to its three-dimensional shape. The presence of an aminomethyl group suggests potential for reactivity and interaction with other chemical species, making it of interest in medicinal chemistry and drug design. The two dioxane-like oxygen atoms in the structure may impart solubility characteristics and influence the compound's overall polarity. Additionally, the tert-butyl group (1,1-dimethylethyl) can enhance the compound's stability and steric hindrance, potentially affecting its biological activity. Overall, this compound's intricate structure and functional groups may provide unique properties that could be explored for various applications in pharmaceuticals or materials science.

Formula: C₁₃H₂₄N₂O₄

InChI: InChI=1S/C13H24N2O4/c1-12(2,3)19-11(16)15-4-5-18-13(8-15)6-10(7-14)17-9-13/h10H,4-9,14H2,1-3H3

InChI key: InChIKey=MECDCDBYHFJSDY-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC2(CC(CN)OC2)OCC1

Synonyms:

• 1,1-Dimethylethyl 3-(aminomethyl)-2,6-dioxa-9-azaspiro[4.5]decane-9-carboxylate
• 2,6-Dioxa-9-azaspiro[4.5]decane-9-carboxylic acid, 3-(aminomethyl)-, 1,1-dimethylethyl ester