CAS 1330763-32-0

1,1-Dimethylethyl 3-(iodomethyl)-2-oxa-9-azaspiro[5.5]undecane-9-carboxylate

Description:

1,1-Dimethylethyl 3-(iodomethyl)-2-oxa-9-azaspiro[5.5]undecane-9-carboxylate is a complex organic compound characterized by its unique spirocyclic structure, which includes a nitrogen atom in a spiro configuration. The presence of the iodomethyl group suggests reactivity, particularly in nucleophilic substitution reactions, while the ester functional group indicates potential for hydrolysis and other reactions typical of carboxylates. The compound also features an ether linkage, contributing to its overall stability and solubility in organic solvents. Its molecular structure implies potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the nitrogen atom which can participate in various biological interactions. Additionally, the bulky tert-butyl group may influence the compound's steric properties, affecting its reactivity and interactions with biological targets. Overall, this compound's unique structural features and functional groups make it a subject of interest for further research in synthetic and medicinal chemistry.

Formula: C₁₅H₂₆INO₃

InChI: InChI=1S/C15H26INO3/c1-14(2,3)20-13(18)17-8-6-15(7-9-17)5-4-12(10-16)19-11-15/h12H,4-11H2,1-3H3

InChI key: InChIKey=VGHJXOOELHXTLQ-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CCC2(CC1)CCC(CI)OC2

Synonyms:

• 2-Oxa-9-azaspiro[5.5]undecane-9-carboxylic acid, 3-(iodomethyl)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3-(iodomethyl)-2-oxa-9-azaspiro[5.5]undecane-9-carboxylate

Tert-Butyl 3-(Iodomethyl)-2-Oxa-9-Azaspiro[5.5]Undecane-9-Carboxylate

CAS: 1330763-32-0

Versatile small molecule scaffold

Formula: C₁₅H₂₆NO₃I

Purity: Min. 95%

Molecular weight: 395.27 g/mol

Ref: 3D-FDC76332