CAS 1330763-54-6

Phenylmethyl 2,3-dihydro-1-oxospiro[isoquinoline-4(1H),4′-piperidine]-1′-carboxylate

Description:

Phenylmethyl 2,3-dihydro-1-oxospiro[isoquinoline-4(1H),4′-piperidine]-1′-carboxylate, identified by its CAS number 1330763-54-6, is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both isoquinoline and piperidine moieties. This compound typically exhibits properties associated with spiro compounds, such as potential biological activity and structural rigidity due to the spiro linkage. The presence of the carboxylate group suggests it may participate in various chemical reactions, including esterification and nucleophilic attacks. Additionally, the compound's isoquinoline structure may contribute to pharmacological properties, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on the specific functional groups and the overall molecular architecture. As with many organic compounds, its behavior in biological systems and potential applications in drug development would require further investigation through experimental studies.

Formula: C₂₁H₂₂N₂O₃

InChI: InChI=1S/C21H22N2O3/c24-19-17-8-4-5-9-18(17)21(15-22-19)10-12-23(13-11-21)20(25)26-14-16-6-2-1-3-7-16/h1-9H,10-15H2,(H,22,24)

InChI key: InChIKey=JABLLZLPDTVNMP-UHFFFAOYSA-N

SMILES: O=C1C=2C(C3(CCN(C(OCC4=CC=CC=C4)=O)CC3)CN1)=CC=CC2

Synonyms:

• Phenylmethyl 2,3-dihydro-1-oxospiro[isoquinoline-4(1H),4′-piperidine]-1′-carboxylate
• Spiro[isoquinoline-4(1H),4′-piperidine]-1′-carboxylic acid, 2,3-dihydro-1-oxo-, phenylmethyl ester