CAS 1330763-95-5

1,1-Dimethylethyl 1,6-diazaspiro[3.3]heptane-1-carboxylate

Description:

1,1-Dimethylethyl 1,6-diazaspiro[3.3]heptane-1-carboxylate, identified by its CAS number 1330763-95-5, is a chemical compound characterized by its unique spirocyclic structure, which includes a diaza (two nitrogen atoms) framework. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric bulk, which can influence its interactions with other molecules, potentially affecting its biological activity and stability. The spirocyclic nature of the compound may impart specific conformational characteristics, making it of interest in medicinal chemistry and drug design. Additionally, the nitrogen atoms in the diazaspiro structure can participate in hydrogen bonding, which may play a role in the compound's solubility and interaction with biological targets. Overall, this compound's unique structural features suggest potential applications in various fields, including pharmaceuticals and materials science, although specific applications would depend on further research and characterization.

Formula: C₁₀H₁₈N₂O₂

InChI: InChI=1S/C10H18N2O2/c1-9(2,3)14-8(13)12-5-4-10(12)6-11-7-10/h11H,4-7H2,1-3H3

InChI key: InChIKey=LKTBVNSJVPWOKC-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C2(CC1)CNC2

Synonyms:

• 3,6-Diazaspiro[3.3]heptane-3-carboxylic acid tert-butyl ester
• tert-Butyl 1,6-diazaspiro[3.3]heptane-1-carboxylate
• 1,6-Diazaspiro[3.3]heptane-1-carboxylic acid, 1,1-dimethylethyl ester
• tert-Butyl 1,6-diazaspiro[3.3]heptan-1-carboxylate
• 1,1-Dimethylethyl 1,6-diazaspiro[3.3]heptane-1-carboxylate

1,6-Diazaspiro[3.3]heptane-1-carboxylic acid, 1,1-dimethylethyl ester

CAS: 1330763-95-5

Formula: C₁₀H₁₈N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 198.2621

Ref: IN-DA001476