CymitQuimica logo

CAS 1330764-04-9

:

1,1-Dimethylethyl 10-oxo-7-oxa-2-azaspiro[4.5]decane-2-carboxylate

Description:
1,1-Dimethylethyl 10-oxo-7-oxa-2-azaspiro[4.5]decane-2-carboxylate, identified by its CAS number 1330764-04-9, is a chemical compound characterized by its unique spirocyclic structure, which includes both a carboxylate and an oxo functional group. The presence of the 2-aza moiety indicates that it contains a nitrogen atom within a cyclic framework, contributing to its potential biological activity. The dimethyl substituent enhances its steric properties, which may influence its reactivity and interaction with biological targets. This compound is likely to exhibit moderate to high lipophilicity due to its hydrophobic regions, which can affect its solubility in various solvents. Additionally, the spiro structure may impart rigidity, influencing its conformational dynamics and stability. Such compounds are often of interest in medicinal chemistry and drug design, as their unique structural features can lead to specific interactions with biological macromolecules. Further studies would be necessary to elucidate its full range of properties and potential applications.
Formula:C13H21NO4
InChI:InChI=1S/C13H21NO4/c1-12(2,3)18-11(16)14-6-5-13(8-14)9-17-7-4-10(13)15/h4-9H2,1-3H3
InChI key:InChIKey=LHCUKGWVVSZXRQ-UHFFFAOYSA-N
SMILES:O=C1C2(CN(C(OC(C)(C)C)=O)CC2)COCC1
Synonyms:
  • 1,1-Dimethylethyl 10-oxo-7-oxa-2-azaspiro[4.5]decane-2-carboxylate
  • 7-Oxa-2-azaspiro[4.5]decane-2-carboxylic acid, 10-oxo-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.