CAS 1330764-07-2

1,1-Dimethylethyl 2-(methylsulfonyl)spiro[5H-pyrano[4,3-d]pyrimidine-8(7H),3′-pyrrolidine]-1′-carboxylate

Description:

1,1-Dimethylethyl 2-(methylsulfonyl)spiro[5H-pyrano[4,3-d]pyrimidine-8(7H),3′-pyrrolidine]-1′-carboxylate, identified by its CAS number 1330764-07-2, is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both pyrano and pyrimidine moieties. This compound features a dimethyl group that enhances its steric properties, while the methylsulfonyl group contributes to its potential reactivity and solubility in various solvents. The presence of the carboxylate functional group suggests that it may exhibit acidic properties, which could influence its interactions in biological systems or chemical reactions. Additionally, the spiro configuration indicates a three-dimensional arrangement that may affect its biological activity and pharmacokinetics. Such compounds are often of interest in medicinal chemistry due to their potential therapeutic applications, particularly in the development of novel pharmaceuticals. Overall, the structural complexity and functional groups present in this compound suggest a diverse range of chemical behaviors and potential applications in various fields, including drug discovery and materials science.

Formula: C₁₆H₂₃N₃O₅S

InChI: InChI=1S/C16H23N3O5S/c1-15(2,3)24-14(20)19-6-5-16(9-19)10-23-8-11-7-17-13(18-12(11)16)25(4,21)22/h7H,5-6,8-10H2,1-4H3

InChI key: InChIKey=UNBGXDKKOSTRFB-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC2(C=3C(=CN=C(S(C)(=O)=O)N3)COC2)CC1

Synonyms:

• 1,1-Dimethylethyl 2-(methylsulfonyl)spiro[5H-pyrano[4,3-d]pyrimidine-8(7H),3′-pyrrolidine]-1′-carboxylate
• Spiro[5H-pyrano[4,3-d]pyrimidine-8(7H),3′-pyrrolidine]-1′-carboxylic acid, 2-(methylsulfonyl)-, 1,1-dimethylethyl ester