CAS 1330765-76-8
:1,1-Dimethylethyl 6,7-dihydro-5-oxospiro[1,6-naphthyridine-8(5H),4′-piperidine]-1′-carboxylate
Description:
1,1-Dimethylethyl 6,7-dihydro-5-oxospiro[1,6-naphthyridine-8(5H),4′-piperidine]-1′-carboxylate, identified by its CAS number 1330765-76-8, is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both a naphthyridine and a piperidine moiety. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of the dimethyl group enhances its steric bulk, which may influence its biological activity and interaction with other molecules. Typically, compounds of this nature are studied for their pharmacological properties, as they may exhibit significant biological activity due to their structural complexity. The compound's stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure. Overall, this compound represents a class of molecules that may have applications in medicinal chemistry and drug development.
Formula:C17H23N3O3
InChI:InChI=1S/C17H23N3O3/c1-16(2,3)23-15(22)20-9-6-17(7-10-20)11-19-14(21)12-5-4-8-18-13(12)17/h4-5,8H,6-7,9-11H2,1-3H3,(H,19,21)
InChI key:InChIKey=DJFBDYSETMLRIJ-UHFFFAOYSA-N
SMILES:O=C1C=2C(C3(CCN(C(OC(C)(C)C)=O)CC3)CN1)=NC=CC2
Synonyms:- Spiro[1,6-naphthyridine-8(5H),4′-piperidine]-1′-carboxylic acid, 6,7-dihydro-5-oxo-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 6,7-dihydro-5-oxospiro[1,6-naphthyridine-8(5H),4′-piperidine]-1′-carboxylate
- tert-Butyl 5-oxospiro[6,7-dihydro-1,6-naphthyridine-8,4'-piperidine]-1'-carboxylate
- tert-Butyl 5-oxo-6,7-dihydro-5H-spiro[[1,6]naphthyridine-8,4'-piperidine]-1'-carboxylate
- Tert-Butyl 5-Oxo-6,7-Dihydro-5H-Spiro[[1,6]Naphthyridine-8,4'-Piperidine]-1'-Carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 5-oxo-6,7-dihydro-5H-spiro[[1,6]naphthyridine-8,4'-piperidine]-1'-carboxylate
CAS:Formula:C17H23N3O3Molecular weight:317.3828
