CymitQuimica logo

CAS 133077-42-6

:

3-(3-Fluorophenoxy)propanoic acid

Description:
3-(3-Fluorophenoxy)propanoic acid is an organic compound characterized by its propanoic acid backbone substituted with a 3-fluorophenoxy group. This compound features a fluorine atom attached to a phenyl ring, which can influence its chemical reactivity and biological activity. The presence of the carboxylic acid functional group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The fluorine atom can enhance lipophilicity and alter the compound's interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the phenoxy group can contribute to the compound's stability and solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. As with many fluorinated compounds, it may exhibit unique properties such as increased metabolic stability or altered pharmacokinetics. Safety and handling precautions should be observed due to the potential toxicity associated with fluorinated organic compounds.
Formula:C9H9FO3
InChI:InChI=1S/C9H9FO3/c10-7-2-1-3-8(6-7)13-5-4-9(11)12/h1-3,6H,4-5H2,(H,11,12)
InChI key:InChIKey=TWGIQPNNPXKPLC-UHFFFAOYSA-N
SMILES:O(CCC(O)=O)C1=CC(F)=CC=C1
Synonyms:
  • 3-(3-Fluorophenoxy)propionic acid
  • Propanoic acid, 3-(3-fluorophenoxy)-
  • 3-(3-Fluorophenoxy)propanoic acid
Found 4 products.