CAS 133081-25-1
:6-[2-(tert-Butoxycarbonyl)hydrazinyl]nicotinic acid
Description:
6-[2-(tert-Butoxycarbonyl)hydrazinyl]nicotinic acid, identified by its CAS number 133081-25-1, is a chemical compound that features a nicotinic acid moiety substituted with a hydrazine derivative. This compound typically exhibits characteristics associated with both hydrazine and carboxylic acid functional groups, which may contribute to its reactivity and potential applications in organic synthesis or medicinal chemistry. The tert-butoxycarbonyl (Boc) group serves as a protective group for the hydrazine functionality, enhancing the stability of the compound during various chemical reactions. The presence of the nicotinic acid structure suggests potential biological activity, as nicotinic acid derivatives are often investigated for their roles in pharmacology. Additionally, the compound's solubility and stability can be influenced by the presence of the hydrazine and carboxylic acid groups, making it suitable for specific applications in research and development. Overall, this compound represents a versatile building block in the synthesis of more complex molecules, particularly in the fields of drug discovery and organic chemistry.
Formula:C11H15N3O4
InChI:InChI=1S/C11H15N3O4/c1-11(2,3)18-10(17)14-13-8-5-4-7(6-12-8)9(15)16/h4-6H,1-3H3,(H,12,13)(H,14,17)(H,15,16)
InChI key:InChIKey=DBNGJNCAXKNLLQ-UHFFFAOYSA-N
SMILES:N(NC(OC(C)(C)C)=O)C1=CC=C(C(O)=O)C=N1
Synonyms:- 3-Pyridinecarboxylic acid, 6-[1-[(1,1-dimethylethoxy)carbonyl]hydrazinyl]-
- 3-Pyridinecarboxylic acid, 6-[2-[(1,1-dimethylethoxy)carbonyl]hydrazino]-
- 6-Boc-Hynic
- 6-Boc-hydrazinopyridine-3-carboxylic 6-[2-(tert-butoxycarbonyl)hydrazinyl]pyridine-3-carboxylic acid
- 6-[1-[(1,1-Dimethylethoxy)carbonyl]hydrazinyl]-3-pyridinecarboxylic acid
- 6-[2-[(tert-Butoxy)carbonyl]hydrazinyl]-3-pyridinecarboxylic acid
- 6-[2-(tert-Butoxycarbonyl)hydrazinyl]nicotinic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Pyridinecarboxylic acid, 6-[1-[(1,1-dimethylethoxy)carbonyl]hydrazinyl]-
CAS:Formula:C11H15N3O4Purity:96%Color and Shape:SolidMolecular weight:253.25456-(2-(tert-Butoxycarbonyl)hydrazinyl)nicotinic acid
CAS:6-(2-(tert-Butoxycarbonyl)hydrazinyl)nicotinic acidPurity:96%Molecular weight:253.258g/mol6-Boc-Hynic
CAS:Controlled Product<p>Applications 6-(2-(tert-Butoxycarbonyl)hydrazono)-1,6-dihydropyridine-3-carboxylic acid (cas# 133081-25-1) is a useful research chemical.<br></p>Formula:C11H15N3O4Color and Shape:NeatMolecular weight:253.2556-Boc-hydrazinonicotinicacid
CAS:6-Boc-hydrazinonicotinicacid is a cytotoxic compound that binds to hydroxyapatite and induces necrosis in cancer cells. This compound also has antimicrobial properties. 6-Boc-hydrazinonicotinic acid is conjugated with peptides for use as an immunoconjugate for the targeted delivery of drugs to cancer cells. It can be used to diagnose cancer by its uptake in human serum and inflammatory cells, as well as to identify cancerous tissues through its binding to hydroxyapatite. The biological studies have shown that 6-Boc-hydrazinonicotinic acid inhibits the growth of various types of tumour cells, including breast, prostate, colon, and lung cancers.Formula:C11H15N3O4Purity:Min. 95%Color and Shape:PowderMolecular weight:253.25 g/mol6-Boc-Hydrazynonicotinic acid
CAS:Formula:C11H15N3O4Purity:96%Color and Shape:Solid, Crystalline PowderMolecular weight:253.258




