CymitQuimica logo

CAS 133088-94-5

:

7-nitroheptan-1-ol

Description:
7-Nitroheptan-1-ol is an organic compound characterized by the presence of a nitro group (-NO2) and a hydroxyl group (-OH) attached to a heptane backbone. The molecular structure indicates that the nitro group is located at the seventh carbon of the heptane chain, while the hydroxyl group is positioned at the first carbon, making it a primary alcohol. This compound is typically a colorless to pale yellow liquid, exhibiting moderate solubility in water due to the polar nature of the hydroxyl group. Its chemical properties are influenced by both the alcohol and nitro functionalities, which can participate in various chemical reactions, including nucleophilic substitutions and reductions. The presence of the nitro group can also impart unique reactivity, making it a potential candidate for further chemical transformations in synthetic organic chemistry. Safety data should be consulted, as nitro compounds can be sensitive to heat and shock, and the compound may pose health risks if not handled properly.
Formula:C7H15NO3
InChI:InChI=1/C7H15NO3/c9-7-5-3-1-2-4-6-8(10)11/h9H,1-7H2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.