CAS 1331-11-9
:Ethoxypropanoic acid
Description:
Ethoxypropanoic acid, with the CAS number 1331-11-9, is an organic compound characterized by its structure, which includes an ethoxy group and a propanoic acid moiety. This compound is typically a colorless liquid with a moderate boiling point and is soluble in water and organic solvents, making it versatile for various applications. Ethoxypropanoic acid exhibits properties typical of carboxylic acids, such as the ability to form hydrogen bonds, which contributes to its solubility and reactivity. It can participate in typical acid-base reactions and can act as a weak acid. The presence of the ethoxy group enhances its hydrophilicity compared to other similar compounds, allowing it to be used as a solvent or an intermediate in chemical synthesis. Additionally, it may have applications in the formulation of coatings, adhesives, and other chemical products due to its ability to modify surface properties. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C5H10O3
InChI:InChI=1/C5H10O3/c1-2-8-4-3-5(6)7/h2-4H2,1H3,(H,6,7)
SMILES:CCOCCC(=O)O
Synonyms:- 3-Ethoxypropanoic Acid
- Ethoxypropanoic acid
- Ethoxypropionic acid
- Ethoxypropionicacid
- Propanoic acid, ethoxy-
- Propionic acid, ethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.