CymitQuimica logo

CAS 133111-56-5

:

6-(4-Chlorophenyl)-2,2-dimethyl-7-phenyl-2,3-dihydro-1H-pyrrolizine

Description:
6-(4-Chlorophenyl)-2,2-dimethyl-7-phenyl-2,3-dihydro-1H-pyrrolizine is a chemical compound characterized by its complex structure, which includes a pyrrolizine core—a bicyclic structure featuring a five-membered nitrogen-containing ring fused to a six-membered carbon ring. The presence of a 4-chlorophenyl group and two methyl groups at specific positions contributes to its unique chemical properties and potential biological activity. This compound may exhibit various physical properties such as solubility, melting point, and boiling point, which can be influenced by its molecular structure and substituents. Additionally, the chlorophenyl group may impart specific reactivity and interaction with biological targets, making it of interest in medicinal chemistry. Its CAS number, 133111-56-5, allows for easy identification and retrieval of information regarding its synthesis, applications, and safety data. Overall, this compound represents a class of organic molecules that may have implications in pharmaceutical research and development.
Formula:C21H20ClN
InChI:InChI=1/C21H20ClN/c1-21(2)12-19-20(16-6-4-3-5-7-16)18(13-23(19)14-21)15-8-10-17(22)11-9-15/h3-11,13H,12,14H2,1-2H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.