CAS 133116-84-4
:5-Trifluoromethyl-quinazoline-2,4-d iamine
Description:
5-Trifluoromethyl-quinazoline-2,4-diamine is a chemical compound characterized by its quinazoline core structure, which consists of a fused benzene and pyrimidine ring. The presence of a trifluoromethyl group (-CF3) at the 5-position significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. The compound features two amino groups (-NH2) at the 2 and 4 positions, which can participate in hydrogen bonding and may contribute to its reactivity and solubility in polar solvents. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. Its unique electronic and steric properties, imparted by the trifluoromethyl group and the amino functionalities, make it a valuable candidate for further research in pharmacology and material science. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C9H7F3N4
InChI:InChI=1/C9H7F3N4/c10-9(11,12)4-2-1-3-5-6(4)7(13)16-8(14)15-5/h1-3H,(H4,13,14,15,16)
SMILES:c1cc(c2c(c1)[nH]c(=N)[nH]c2=N)C(F)(F)F
Synonyms:- 5-Trifluoromethyl-quinazoline-2,4-d
- 5-(Trifluoromethyl)Quinazoline-2,4-Diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
