CAS 133118-82-8

8-Bromo-3,4-dihydro-2H-1-benzopyran-3-amine

Description:

8-Bromo-3,4-dihydro-2H-1-benzopyran-3-amine is a chemical compound characterized by its unique structure, which includes a benzopyran moiety and an amine functional group. The presence of the bromine atom at the 8-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound typically exhibits properties associated with both aromatic and aliphatic systems, such as moderate solubility in organic solvents and potential interactions with biological targets due to the amine group. It may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it a versatile intermediate in the synthesis of more complex molecules. Additionally, its structural features suggest potential pharmacological activities, which warrant further investigation in drug development contexts. As with many brominated compounds, considerations regarding environmental impact and safety are essential, particularly in terms of handling and disposal. Overall, 8-Bromo-3,4-dihydro-2H-1-benzopyran-3-amine represents a compound of interest in both synthetic and applied chemistry.

Formula: C₉H₁₀BrNO

InChI: InChI=1S/C9H10BrNO/c10-8-3-1-2-6-4-7(11)5-12-9(6)8/h1-3,7H,4-5,11H2

InChI key: InChIKey=VTWFNZHMJMACOM-UHFFFAOYSA-N

SMILES: BrC1=C2C(CC(N)CO2)=CC=C1

Synonyms:

• 8-Bromo-3,4-dihydro-2H-1-benzopyran-3-amine
• 2H-1-Benzopyran-3-amine, 8-bromo-3,4-dihydro-
• 8-Bromo-3-aminochroman