CymitQuimica logo

CAS 13312-80-6

:

hydroxy(4-nitrophenyl)acetonitrile

Description:
Hydroxy(4-nitrophenyl)acetonitrile, with the CAS number 13312-80-6, is an organic compound characterized by the presence of a hydroxyl group, a nitrophenyl moiety, and an acetonitrile functional group. This compound typically appears as a solid and is soluble in polar organic solvents due to its functional groups. The hydroxyl group contributes to its potential as a hydrogen bond donor, while the nitro group can influence its reactivity and polarity. Hydroxy(4-nitrophenyl)acetonitrile may exhibit biological activity, making it of interest in pharmaceutical and chemical research. Its structure suggests potential applications in organic synthesis, particularly in the development of more complex molecules. The compound's reactivity can be influenced by the electron-withdrawing nature of the nitro group, which can affect nucleophilic attack and other chemical transformations. Safety data should be consulted for handling, as compounds containing nitro groups can sometimes pose hazards. Overall, hydroxy(4-nitrophenyl)acetonitrile is a versatile compound with potential applications in various fields of chemistry.
Formula:C8H6N2O3
InChI:InChI=1/C8H6N2O3/c9-5-8(11)6-1-3-7(4-2-6)10(12)13/h1-4,8,11H
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.