
CAS 13313-45-6
:3-(Methylthio)-N-phenylbenzenamine
Description:
3-(Methylthio)-N-phenylbenzenamine, identified by its CAS number 13313-45-6, is an organic compound characterized by the presence of a phenyl group attached to a benzenamine structure, along with a methylthio substituent at the meta position. This compound typically exhibits properties associated with aromatic amines, including potential solubility in organic solvents and moderate stability under standard conditions. The methylthio group contributes to its unique reactivity and may influence its electronic properties, making it of interest in various chemical applications, including synthesis and as a potential intermediate in organic reactions. Additionally, due to the presence of the amine functional group, it may participate in hydrogen bonding, affecting its physical properties such as boiling and melting points. Safety considerations are important, as many aromatic amines can be toxic or carcinogenic, necessitating careful handling and appropriate safety measures during use. Overall, 3-(Methylthio)-N-phenylbenzenamine is a compound of interest in both industrial and research settings, particularly in the fields of organic synthesis and materials science.
Formula:C13H13NS
InChI:InChI=1S/C13H13NS/c1-15-13-9-5-8-12(10-13)14-11-6-3-2-4-7-11/h2-10,14H,1H3
InChI key:InChIKey=NGTRZJDYCCOXBA-UHFFFAOYSA-N
SMILES:N(C1=CC(SC)=CC=C1)C2=CC=CC=C2
Synonyms:- N-[m-(Methylthio)phenyl]aniline
- 3-(Methylthio)-N-phenylbenzenamine
- Benzenamine, 3-(methylthio)-N-phenyl-
- Diphenylamine, 3-(methylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
