CAS 133132-74-8
:4-chloro-3-methyl-2,2-diphenyl-butanenitrile
Description:
4-Chloro-3-methyl-2,2-diphenyl-butanenitrile, identified by its CAS number 133132-74-8, is a chemical compound characterized by its unique structure, which includes a butanenitrile backbone substituted with a chlorine atom, a methyl group, and two phenyl groups. This compound typically exhibits a solid state at room temperature and is known for its relatively low solubility in water, making it more soluble in organic solvents. The presence of the nitrile functional group contributes to its polar characteristics, while the phenyl groups enhance its hydrophobic nature. The chlorine substituent can influence its reactivity and stability, potentially making it useful in various synthetic applications. Additionally, compounds like this may exhibit biological activity, which could be of interest in pharmaceutical research. Safety data should be consulted for handling and exposure guidelines, as halogenated compounds can pose environmental and health risks. Overall, 4-chloro-3-methyl-2,2-diphenyl-butanenitrile is a compound of interest in organic chemistry and materials science.
Formula:C17H16ClN
InChI:InChI=1/C17H16ClN/c1-14(12-18)17(13-19,15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,14H,12H2,1H3/t14-/m1/s1
SMILES:C[C@H](CCl)C(C#N)(c1ccccc1)c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Chloro-3-methyl-2,2-diphenylbutyronitrile
CAS:Controlled ProductApplications 4-Chloro-3-methyl-2,2-diphenylbutyronitrile, is an intermediate in the synthesis of rac-Moramide (M630200).
Formula:C17H16ClNColor and Shape:NeatMolecular weight:269.77
