CAS 13314-67-5

1-Benzyl-4-(4-methylphenyl)tetrahydropyridine

Description:

1-Benzyl-4-(4-methylphenyl)tetrahydropyridine, with the CAS number 13314-67-5, is a chemical compound that belongs to the class of tetrahydropyridines, which are cyclic amines. This substance features a tetrahydropyridine ring substituted with a benzyl group and a para-methylphenyl group, contributing to its unique structural and electronic properties. It is typically characterized by its moderate polarity, which influences its solubility in organic solvents. The presence of the aromatic rings enhances its stability and may impart specific reactivity patterns, making it of interest in various synthetic applications. Additionally, compounds of this type may exhibit biological activity, potentially interacting with neurotransmitter systems, which has implications in medicinal chemistry. Its synthesis often involves multi-step organic reactions, and it may be used as an intermediate in the production of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₉H₂₁N

InChI: InChI=1/C19H21N/c1-16-7-9-18(10-8-16)19-11-13-20(14-12-19)15-17-5-3-2-4-6-17/h2-11H,12-15H2,1H3

SMILES: Cc1ccc(cc1)C1=CCN(CC1)Cc1ccccc1

Synonyms:

• 1-Benzyl-4-(4-methylphenyl)-1,2,3,6-tetrahydropyridine
• Pyridine, 1,2,3,6-Tetrahydro-4-(4-Methylphenyl)-1-(Phenylmethyl)-

Pyridine,1,2,3,6-tetrahydro-4-(4-methylphenyl)-1-(phenylmethyl)-

CAS: 13314-67-5

Formula: C₁₉H₂₃N

Molecular weight: 265.3926

Ref: IN-DA0014BJ