CAS 13314-96-0
:2-[(phenylamino)methyl]-1H-isoindole-1,3(2H)-dione
Description:
2-[(Phenylamino)methyl]-1H-isoindole-1,3(2H)-dione, also known by its CAS number 13314-96-0, is an organic compound characterized by its isoindole structure, which features a fused ring system comprising a benzene ring and a five-membered nitrogen-containing ring. This compound contains a phenylamino group, indicating the presence of an amino group attached to a phenyl ring, which contributes to its reactivity and potential biological activity. The presence of the dione functional groups suggests that it can participate in various chemical reactions, including nucleophilic additions and condensation reactions. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The compound's unique structure makes it of interest in medicinal chemistry, particularly for its potential applications in drug development and as a building block for synthesizing more complex molecules. Its properties, such as melting point, boiling point, and spectral characteristics, would be determined through experimental methods and may vary based on purity and environmental conditions.
Formula:C15H12N2O2
InChI:InChI=1/C15H12N2O2/c18-14-12-8-4-5-9-13(12)15(19)17(14)10-16-11-6-2-1-3-7-11/h1-9,16H,10H2
SMILES:c1ccc(cc1)NCN1C(=O)c2ccccc2C1=O
Synonyms:- 1H-isoindole-1,3(2H)-dione, 2-[(phenylamino)methyl]-
- 2-(Anilinomethyl)-1H-isoindole-1,3(2H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
