
CAS 13314-97-1
:1-(4-Morpholinylmethyl)-2,5-pyrrolidinedione
Description:
1-(4-Morpholinylmethyl)-2,5-pyrrolidinedione, also known by its CAS number 13314-97-1, is a chemical compound characterized by its unique molecular structure, which includes a pyrrolidine ring and a morpholine moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. It is often studied for its biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for drug development due to its ability to interact with various biological targets. The presence of the morpholine group can enhance its pharmacological properties, including improved bioavailability and selectivity. Additionally, the compound may exhibit moderate to high stability under standard laboratory conditions, although specific reactivity can depend on the functional groups present. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use. Overall, this compound represents a significant interest in the field of organic and medicinal chemistry.
Formula:C9H14N2O3
InChI:InChI=1S/C9H14N2O3/c12-8-1-2-9(13)11(8)7-10-3-5-14-6-4-10/h1-7H2
InChI key:InChIKey=YQXGXEUSFRFHRR-UHFFFAOYSA-N
SMILES:C(N1C(=O)CCC1=O)N2CCOCC2
Synonyms:- 1-(4-Morpholinylmethyl)-2,5-pyrrolidinedione
- 1-(Morpholin-4-ylmethyl)pyrrolidine-2,5-dione
- 2,5-Pyrrolidinedione, 1-(4-morpholinylmethyl)-
- N-(Morpholinomethyl)succinimide
- Succinimide, N-(morpholinomethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
