
CAS 133145-29-6
:6-(Pentyloxy)-1H-benzotriazole
Description:
6-(Pentyloxy)-1H-benzotriazole is an organic compound characterized by its benzotriazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a pentyloxy group, which is a pentyl chain (five carbon atoms) attached via an ether linkage to the benzotriazole. The presence of the pentyloxy group enhances its solubility in organic solvents and may influence its physical and chemical properties, such as melting point and boiling point. Benzotriazoles are known for their applications as UV stabilizers, corrosion inhibitors, and in various industrial processes due to their ability to absorb ultraviolet light. The specific structure of 6-(Pentyloxy)-1H-benzotriazole may also impart unique properties, making it suitable for specialized applications in materials science and organic synthesis. Additionally, the compound's stability and reactivity can be influenced by the substituents on the benzotriazole ring, which can affect its performance in various chemical environments.
Formula:C11H15N3O
InChI:InChI=1S/C11H15N3O/c1-2-3-4-7-15-9-5-6-10-11(8-9)13-14-12-10/h5-6,8H,2-4,7H2,1H3,(H,12,13,14)
InChI key:InChIKey=QOLSSJHPZVQWFE-UHFFFAOYSA-N
SMILES:O(CCCCC)C=1C=C2C(=CC1)N=NN2
Synonyms:- 1H-Benzotriazole, 6-(pentyloxy)-
- 6-(Pentyloxy)-1H-benzotriazole
- 1H-Benzotriazole, 5-(pentyloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
