CymitQuimica logo

CAS 13315-71-4

:

2,4-DIMETHYL-A-CARBOLINE

Description:
2,4-Dimethyl-α-carboline is a chemical compound belonging to the class of α-carbolines, which are bicyclic compounds derived from the indole structure. This specific compound features two methyl groups at the 2 and 4 positions of the carboline ring, influencing its chemical properties and reactivity. It is known for its potential biological activities, including interactions with various receptors and enzymes, which may contribute to its pharmacological effects. The compound is typically characterized by its aromatic nature, which can lead to significant π-π stacking interactions in solid-state or solution environments. Additionally, 2,4-dimethyl-α-carboline may exhibit fluorescence properties, making it of interest in various analytical applications. Its solubility can vary depending on the solvent, and it may participate in hydrogen bonding due to the presence of nitrogen in the ring structure. As with many organic compounds, safety data should be consulted for handling and storage, as it may pose health risks if not managed properly.
Formula:C13H12N2
InChI:InChI=1/C13H12N2/c1-8-7-9(2)14-13-12(8)10-5-3-4-6-11(10)15-13/h3-7H,1-2H3,(H,14,15)
SMILES:Cc1cc(C)nc2c1c1ccccc1[nH]2
Synonyms:
  • 2,4-Dimethyl-alpha-carboline
  • 2,4-dimethyl-9H-pyrido[2,3-b]indole
  • 2,4-Dimethyl-α-carboline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.