CAS 13316-12-6

7-chlorothiazolo[5,4-d]pyrimidine

Description:

7-Chlorothiazolo[5,4-d]pyrimidine is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both thiazole and pyrimidine rings. The presence of a chlorine atom at the 7-position contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both nitrogen and sulfur atoms, which can influence the compound's interaction with biological targets. Additionally, the thiazolo and pyrimidine moieties are known for their roles in various biological processes, making this compound of interest in research related to drug discovery and development. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.

Formula: C₅H₂ClN₃S

InChI: InChI=1/C5H2ClN3S/c6-4-3-5(8-1-7-4)10-2-9-3/h1-2H

SMILES: c1nc(c2c(n1)scn2)Cl

Synonyms:

• 7-Chloro[1,3]thiazolo[5,4-d]pyrimidine
• Thiazolo[5,4-D]Pyrimidine, 7-Chloro-
• 7-Chlorothiazole[5,4-d]pyrimidine

Thiazolo[5,4-d]pyrimidine, 7-chloro-

CAS: 13316-12-6

Formula: C₅H₂ClN₃S

Purity: 95%

Color and Shape: Solid

Molecular weight: 171.6075

Ref: IN-DA0014D2

7-Chlorothiazolo[5,4-d]pyrimidine

CAS: 13316-12-6

7-Chlorothiazolo[5,4-d]pyrimidine

Purity: 97%

Molecular weight: 171.61g/mol

Ref: 54-OR903749

7-Chlorothiazolo[5,4-d]pyrimidine

CAS: 13316-12-6

Formula: C₅H₂ClN₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 171.6

Ref: 10-F093485