CAS 13318-18-8
:Octahydro-4,7-methano-1H-indene-1,2,5-triol
Description:
Octahydro-4,7-methano-1H-indene-1,2,5-triol, with the CAS number 13318-18-8, is a chemical compound characterized by its unique bicyclic structure, which includes a saturated indene framework. This compound features multiple hydroxyl (-OH) groups, contributing to its potential as a polyol. The presence of these hydroxyl groups enhances its solubility in polar solvents and may impart hydrophilic properties. Octahydro-4,7-methano-1H-indene-1,2,5-triol is typically colorless to pale yellow and may exhibit a mild odor. Its molecular structure suggests potential applications in the synthesis of polymers, surfactants, or as a building block in organic synthesis. Additionally, the compound's hydroxyl groups may allow for hydrogen bonding, influencing its reactivity and interactions with other substances. While specific data on its toxicity and environmental impact may not be extensively documented, compounds with similar structures often require careful handling due to their reactivity and potential biological effects. Overall, this compound represents an interesting subject for further research in organic chemistry and materials science.
Formula:C10H16O3
InChI:InChI=1S/C10H16O3/c11-7-2-4-1-5(7)6-3-8(12)10(13)9(4)6/h4-13H,1-3H2
InChI key:InChIKey=RWQFKYRYAQYIQR-UHFFFAOYSA-N
SMILES:OC1C2C(C3CC2CC3O)CC1O
Synonyms:- Hexahydro-4,7-methanoindan-1,2,5-triol
- 4,7-Methano-1H-indene-1,2,5-triol, octahydro-
- Octahydro-4,7-methano-1H-indene-1,2,5-triol
- 4,7-Methanoindan-1,2,5-triol, hexahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
