CAS 1331823-96-1
:1-[2-(4-Thiomorpholinyl)ethyl]-2-imidazolidinone
Description:
1-[2-(4-Thiomorpholinyl)ethyl]-2-imidazolidinone is a chemical compound characterized by its unique structure, which includes an imidazolidinone ring and a thiomorpholine moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. The presence of the thiomorpholine group suggests that it may possess interesting pharmacological properties, potentially acting as a ligand or inhibitor in biological systems. The imidazolidinone structure can contribute to its stability and reactivity, making it a candidate for various chemical reactions or applications in medicinal chemistry. Additionally, the compound may exhibit specific functional properties, such as the ability to form hydrogen bonds, which can influence its interactions with biological targets. Overall, 1-[2-(4-Thiomorpholinyl)ethyl]-2-imidazolidinone represents a class of compounds that could be of interest in drug development and synthetic chemistry due to its structural features and potential biological activity.
Formula:C9H17N3OS
InChI:InChI=1S/C9H17N3OS/c13-9-10-1-2-12(9)4-3-11-5-7-14-8-6-11/h1-8H2,(H,10,13)
InChI key:InChIKey=FAQHBYPVKKSELK-UHFFFAOYSA-N
SMILES:C(CN1CCSCC1)N2C(=O)NCC2
Synonyms:- 1-[2-(4-Thiomorpholinyl)ethyl]-2-imidazolidinone
- 2-Imidazolidinone, 1-[2-(4-thiomorpholinyl)ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.