CymitQuimica logo

CAS 1331823-97-2

:

Ethyl 7-chloro-8-iodoimidazo[1,2-a]pyridine-2-carboxylate

Description:
Ethyl 7-chloro-8-iodoimidazo[1,2-a]pyridine-2-carboxylate is a heterocyclic compound characterized by its imidazo-pyridine structure, which incorporates both chlorine and iodine substituents. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of halogens, specifically chlorine and iodine, suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as these elements can influence biological activity and molecular interactions. The imidazo[1,2-a]pyridine framework is known for its role in various biological systems and can serve as a scaffold for drug design. Additionally, the carboxylate group enhances the compound's ability to participate in various chemical reactions, including esterification and nucleophilic substitutions. Overall, this compound's unique structural features and functional groups make it a subject of interest in synthetic organic chemistry and drug discovery.
Formula:C10H8ClIN2O2
InChI:InChI=1S/C10H8ClIN2O2/c1-2-16-10(15)7-5-14-4-3-6(11)8(12)9(14)13-7/h3-5H,2H2,1H3
InChI key:InChIKey=IIRCJIUYBPOGBX-UHFFFAOYSA-N
SMILES:IC=1C=2N(C=C(C(OCC)=O)N2)C=CC1Cl
Synonyms:
  • Ethyl 7-chloro-8-iodoimidazo[1,2-a]pyridine-2-carboxylate
  • Imidazo[1,2-a]pyridine-2-carboxylic acid, 7-chloro-8-iodo-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.