CymitQuimica logo

CAS 1331823-98-3

:

7-Chloro-8-iodo-2-(trifluoromethyl)imidazo[1,2-a]pyridine

Description:
7-Chloro-8-iodo-2-(trifluoromethyl)imidazo[1,2-a]pyridine is a heterocyclic compound characterized by the presence of both imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of chlorine and iodine substituents enhances its reactivity and potential for forming various derivatives. The trifluoromethyl group is notable for imparting lipophilicity and influencing the compound's electronic properties, making it of interest in medicinal chemistry and material science. This compound may exhibit biological activity due to its structural features, which can interact with biological targets. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of novel therapeutic agents. Additionally, the presence of halogens can affect the compound's solubility and stability, which are critical factors in drug design. Overall, 7-Chloro-8-iodo-2-(trifluoromethyl)imidazo[1,2-a]pyridine represents a versatile scaffold for further chemical exploration and development.
Formula:C8H3ClF3IN2
InChI:InChI=1S/C8H3ClF3IN2/c9-4-1-2-15-3-5(8(10,11)12)14-7(15)6(4)13/h1-3H
InChI key:InChIKey=HVEULDUNYUCHBM-UHFFFAOYSA-N
SMILES:IC=1C=2N(C=C(C(F)(F)F)N2)C=CC1Cl
Synonyms:
  • 7-Chloro-8-iodo-2-(trifluoromethyl)imidazo[1,2-a]pyridine
  • Imidazo[1,2-a]pyridine, 7-chloro-8-iodo-2-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.