CymitQuimica logo

CAS 1331846-59-3

:

8-Methyl-3-azabicyclo[3.2.1]octan-8-ol

Description:
8-Methyl-3-azabicyclo[3.2.1]octan-8-ol is a bicyclic organic compound characterized by its unique bicyclic structure, which includes a nitrogen atom integrated into the ring system. This compound features a hydroxyl (-OH) group and a methyl (-CH3) substituent, contributing to its chemical reactivity and potential biological activity. The presence of the nitrogen atom suggests that it may exhibit properties similar to those of alkaloids, which often have significant pharmacological effects. The bicyclic framework provides rigidity, which can influence the compound's interaction with biological targets. Additionally, the stereochemistry of the compound can play a crucial role in its activity, as different conformations may lead to varying affinities for receptors or enzymes. Overall, 8-Methyl-3-azabicyclo[3.2.1]octan-8-ol is of interest in medicinal chemistry and drug development, particularly in the context of designing compounds that can modulate biological pathways or serve as potential therapeutic agents.
Formula:C8H15NO
InChI:InChI=1S/C8H15NO/c1-8(10)6-2-3-7(8)5-9-4-6/h6-7,9-10H,2-5H2,1H3
InChI key:InChIKey=LSXZDFSMECALBQ-UHFFFAOYSA-N
SMILES:CC1(O)C2CCC1CNC2
Synonyms:
  • 8-Methyl-3-azabicyclo[3.2.1]octan-8-ol
  • 3-Azabicyclo[3.2.1]octan-8-ol, 8-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.