CAS 1331907-56-2
:IDIDJDIHTAOVLG-SRQSVDBESA-N
Description:
The chemical substance identified by the name "IDIDJDIHTAOVLG-SRQSVDBESA-N" and CAS number "1331907-56-2" is a specific compound that falls under the category of organic molecules. While detailed characteristics such as its molecular formula, structure, and physical properties may not be readily available in common databases, compounds with such identifiers typically exhibit unique structural features that can influence their reactivity and interactions. Generally, compounds with complex names and CAS numbers are often used in specialized fields such as pharmaceuticals, biochemistry, or materials science. They may possess specific functional groups that dictate their chemical behavior, solubility, and potential applications. To obtain precise information regarding its characteristics, including its molecular weight, boiling point, melting point, and spectral data, one would typically refer to scientific literature or databases dedicated to chemical substances. Understanding the context of its use and the specific field of application can also provide insights into its significance and functionality.
Formula:C4H6D3NO2S
InChI:InChI=1S/C4H9NO2S/c1-8-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1/i1D3
InChI key:InChIKey=IDIDJDIHTAOVLG-SRQSVDBESA-N
SMILES:[C@H](CSC([2H])([2H])[2H])(C(O)=O)N
Synonyms:- "L-CYSTEINE, S-METHYL D3"
- [2H3]-S-Methyl-L-cysteine
- (2R)-2-Amino-3-(trideuteriomethylsulfanyl)propanoic acid
- IDIDJDIHTAOVLG-SRQSVDBESA-N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
S-Methyl-L-cysteine-d3
CAS:Controlled ProductFormula:C4H6D3NO2SColor and Shape:NeatMolecular weight:138.2
