CAS 1331912-45-8

4-(1-Fluoroethenyl)pyridine

Description:

4-(1-Fluoroethenyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a fluoroethenyl group at the 4-position of the pyridine ring introduces unique reactivity and properties. This compound typically exhibits a polar nature due to the electronegative fluorine atom, which can influence its solubility in various solvents. It may participate in electrophilic aromatic substitution reactions due to the electron-withdrawing effect of the fluorine, making the aromatic ring more reactive. Additionally, the compound's structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Its specific physical properties, such as boiling point, melting point, and spectral characteristics, would depend on the molecular interactions and the environment in which it is studied. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance.

Formula: C₇H₆FN

InChI: InChI=1S/C7H6FN/c1-6(8)7-2-4-9-5-3-7/h2-5H,1H2

InChI key: InChIKey=WRWKKVYVZRQKFL-UHFFFAOYSA-N

SMILES: C(=C)(F)C=1C=CN=CC1

Synonyms:

• Pyridine, 4-(1-fluoroethenyl)-
• 4-(1-Fluoroethenyl)pyridine