CymitQuimica logo

CAS 1331943-89-5

:

4-Bromo-3-(difluoromethoxy)benzenemethanol

Description:
4-Bromo-3-(difluoromethoxy)benzenemethanol is an organic compound characterized by its complex structure, which includes a bromine atom and a difluoromethoxy group attached to a benzene ring. The presence of the bromine substituent typically imparts increased reactivity, particularly in nucleophilic substitution reactions. The difluoromethoxy group contributes to the compound's polarity and can influence its solubility in various solvents. As a benzenemethanol derivative, it features a hydroxymethyl group, which can participate in hydrogen bonding, enhancing its potential interactions in biological systems or chemical reactions. The compound's unique combination of halogen and functional groups may also affect its stability, reactivity, and potential applications in pharmaceuticals or agrochemicals. Additionally, the presence of fluorine atoms often enhances metabolic stability and lipophilicity, making such compounds of interest in medicinal chemistry. Overall, 4-Bromo-3-(difluoromethoxy)benzenemethanol exhibits properties that could be valuable in various chemical and biological contexts.
Formula:C8H7BrF2O2
InChI:InChI=1S/C8H7BrF2O2/c9-6-2-1-5(4-12)3-7(6)13-8(10)11/h1-3,8,12H,4H2
InChI key:InChIKey=DNRZPJOIOXMJCA-UHFFFAOYSA-N
SMILES:O(C(F)F)C1=CC(CO)=CC=C1Br
Synonyms:
  • 4-Bromo-3-(difluoromethoxy)benzenemethanol
  • Benzenemethanol, 4-bromo-3-(difluoromethoxy)-
  • [4-Bromo-3-(difluoromethoxy)phenyl]methanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.