CAS 13320-48-4

4-(4-BROMOPHENOXY)PHENOL

Description:

4-(4-Bromophenoxy)phenol, with the CAS number 13320-48-4, is an organic compound characterized by its phenolic structure, which includes a bromophenyl group and a hydroxyl group. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. It exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many phenolic compounds. The presence of the bromine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. Additionally, the compound may display antioxidant properties due to the hydroxyl group, which can donate hydrogen atoms to free radicals. Safety considerations should be taken into account when handling this substance, as it may pose health risks if ingested or inhaled. Overall, 4-(4-Bromophenoxy)phenol is a versatile compound with significant implications in research and industrial applications.

Formula: C₁₂H₉BrO₂

InChI: InChI=1/C12H9BrO2/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8,14H

SMILES: c1cc(ccc1Br)Oc1ccc(cc1)O

Synonyms:

• Phenol, 4-(4-Bromophenoxy)-

Phenol, 4-(4-bromophenoxy)-

CAS: 13320-48-4

Formula: C₁₂H₉BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 265.1027

Ref: IN-DA0014ET

4-(4-Bromophenoxy)Phenol

CAS: 13320-48-4

4-(4-Bromophenoxy)Phenol

Purity: 98%

Molecular weight: 265.10g/mol

Ref: 54-OR1011128

4-(4-Bromophenoxy)phenol

CAS: 13320-48-4

Formula: C₁₂H₉BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 265.106

Ref: 10-F494043