CymitQuimica logo

CAS 133209-22-0

:

Bicyclo[2.2.1]heptane-2,3-dithiol

Description:
Bicyclo[2.2.1]heptane-2,3-dithiol is a bicyclic organic compound characterized by its unique structure, which consists of a bicycloheptane framework with two thiol (-SH) groups located at the 2 and 3 positions. This compound is notable for its potential applications in organic synthesis and materials science due to the presence of the thiol groups, which can participate in various chemical reactions, including nucleophilic substitutions and the formation of disulfide bonds. The bicyclic structure contributes to its rigidity and may influence its reactivity and interaction with other molecules. Additionally, the compound's physical properties, such as boiling point and solubility, can be affected by the presence of the thiol groups, which can engage in hydrogen bonding. Bicyclo[2.2.1]heptane-2,3-dithiol may also exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Overall, its unique structural features and functional groups make it a valuable compound for further research and application in various chemical fields.
Formula:C7H12S2
InChI:InChI=1S/C7H12S2/c8-6-4-1-2-5(3-4)7(6)9/h4-9H,1-3H2
InChI key:InChIKey=SIDLLBGYFXERTQ-UHFFFAOYSA-N
SMILES:SC1C2CC(C1S)CC2
Synonyms:
  • Bicyclo[2.2.1]heptane-2,3-dithiol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.