CAS 13321-61-4
:[2-(ETHOXYCARBONYL)-2-OXOETHYLIDENE]TRIPHENYLPHOSPHORANE
Description:
[2-(Ethoxycarbonyl)-2-oxoethylidene]triphenylphosphorane, with the CAS number 13321-61-4, is a chemical compound that features a phosphorane structure, characterized by the presence of a phosphorus atom bonded to three phenyl groups and a carbonyl-containing substituent. This compound typically exhibits properties associated with phosphoranes, such as being a strong nucleophile due to the presence of the phosphorus atom, which can participate in various chemical reactions, including nucleophilic substitutions and additions. The ethoxycarbonyl group contributes to its reactivity, making it useful in organic synthesis, particularly in the formation of carbon-carbon bonds. Additionally, the compound may display moderate solubility in organic solvents, influenced by the bulky triphenyl groups that can affect steric hindrance and electronic properties. Its stability and reactivity can be further modulated by the surrounding functional groups, making it a versatile intermediate in synthetic chemistry. As with many phosphoranes, care should be taken when handling this compound due to potential reactivity and toxicity.
Formula:C23H21O3P
InChI:InChI=1/C23H21O3P/c1-2-26-23(25)22(24)18-27(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-18H,2H2,1H3
SMILES:CCOC(=O)C(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1
Synonyms:- Ethyl (Triphenylphosphoranylidene)Pyruvate
- Ethyl(triphenylphosphoranylid
- [2-(Ethoxycarbonyl)-2-oxoethylidene]triphenylphosphorane , 95 % min.
- Ethyl 2-Oxo-3-(Triphenyl-Lambda~5~-Phosphanylidene)Propanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Propanoic acid, 2-oxo-3-(triphenylphosphoranylidene)-, ethyl ester
CAS:Formula:C23H21O3PPurity:98%Color and Shape:SolidMolecular weight:376.3848Ethyl 2-oxo-3-(triphenylphosphoranylidene)propanoate
CAS:Ethyl 2-oxo-3-(triphenylphosphoranylidene)propanoate
Purity:95%Color and Shape:PowderMolecular weight:376.38g/molEthyl 2-oxo-3-(triphenylphosphoranylidene)propanoate
CAS:Ethyl 2-oxo-3-(triphenylphosphoranylidene)propanoate is a high quality reagent for the preparation of complex compounds. This compound has been used as a useful intermediate in the synthesis of fine chemicals and speciality chemicals. It is also an important reaction component for the preparation of versatile building blocks.Formula:C23H21O3PPurity:Min. 95%Color and Shape:PowderMolecular weight:376.38 g/mol



